C10H8F18O8S2 — CID 87127947
ethane-1,1-diol;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid) (PubChem CID 87127947) has the molecular formula C10H8F18O8S2 and a molecular weight of 662.26 g/mol. Its IUPAC name is ethane-1,1-diol;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid).
| Compound Name | ethane-1,1-diol;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid) |
|---|---|
| PubChem CID | 87127947 |
| Molecular Formula | C10H8F18O8S2 |
| Molecular Weight | 662.26 g/mol |
| Exact Mass | 661.94 |
| IUPAC Name | ethane-1,1-diol;bis(1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid) |
| SMILES | CC(O)O.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C4HF9O3S.C2H6O2/c2*5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;1-2(3)4/h2*(H,14,15,16);2-4H,1H3 |
| InChIKey | UJAMSIKAHXFVDO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|