C6H9F9N2O3S — CID 134814664
azanium 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethanolate (PubChem CID 134814664) has the molecular formula C6H9F9N2O3S and a molecular weight of 360.20 g/mol. Its IUPAC name is azanium 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethanolate.
| Compound Name | azanium 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethanolate |
|---|---|
| PubChem CID | 134814664 |
| Molecular Formula | C6H9F9N2O3S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | azanium 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethanolate |
| SMILES | O=S(=O)(NCC[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C6H5F9NO3S.H3N/c7-3(8,5(11,12)13)4(9,10)6(14,15)20(18,19)16-1-2-17;/h16H,1-2H2;1H3/q-1;/p+1 |
| InChIKey | UVASEIOPFZQHHC-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|