C8H8F9NO4S — CID 129294908
2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl acetate (PubChem CID 129294908) has the molecular formula C8H8F9NO4S and a molecular weight of 385.20 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl acetate.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl acetate |
|---|---|
| PubChem CID | 129294908 |
| Molecular Formula | C8H8F9NO4S |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl acetate |
| SMILES | CC(=O)OCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F9NO4S/c1-4(19)22-3-2-18-23(20,21)8(16,17)6(11,12)5(9,10)7(13,14)15/h18H,2-3H2,1H3 |
| InChIKey | KTEGNUFLHLGIBX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|