C9H8F9NO4S — CID 87091666
2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl prop-2-enoate (PubChem CID 87091666) has the molecular formula C9H8F9NO4S and a molecular weight of 397.22 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl prop-2-enoate.
| Compound Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 87091666 |
| Molecular Formula | C9H8F9NO4S |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F9NO4S/c1-2-5(20)23-4-3-19-24(21,22)9(17,18)7(12,13)6(10,11)8(14,15)16/h2,19H,1,3-4H2 |
| InChIKey | PLXFAFWGARYVDZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|