C17H19F14NO4S — CID 59689346
2-[[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylamino]ethyl prop-2-enoate (PubChem CID 59689346) has the molecular formula C17H19F14NO4S and a molecular weight of 599.38 g/mol. Its IUPAC name is 2-[[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59689346 |
| Molecular Formula | C17H19F14NO4S |
| Molecular Weight | 599.38 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | 2-[[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNS(=O)(=O)CCCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H19F14NO4S/c1-2-11(33)36-6-5-32-37(34,35)7-3-4-10(8-12(18,14(20,21)22)15(23,24)25)9-13(19,16(26,27)28)17(29,30)31/h2,10,32H,1,3-9H2 |
| InChIKey | DULJMCSIIOZOTP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|