C15H22F10N2O4S — CID 58918829
2-[methyl-[3-[[6,7,7,7-tetrafluoro-4,6-bis(trifluoromethyl)heptyl]sulfonylamino]propyl]amino]acetic acid (PubChem CID 58918829) has the molecular formula C15H22F10N2O4S and a molecular weight of 516.40 g/mol. Its IUPAC name is 2-[methyl-[3-[[6,7,7,7-tetrafluoro-4,6-bis(trifluoromethyl)heptyl]sulfonylamino]propyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-[[6,7,7,7-tetrafluoro-4,6-bis(trifluoromethyl)heptyl]sulfonylamino]propyl]amino]acetic acid |
|---|---|
| PubChem CID | 58918829 |
| Molecular Formula | C15H22F10N2O4S |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 2-[methyl-[3-[[6,7,7,7-tetrafluoro-4,6-bis(trifluoromethyl)heptyl]sulfonylamino]propyl]amino]acetic acid |
| SMILES | CN(CCCNS(=O)(=O)CCCC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C15H22F10N2O4S/c1-27(9-11(28)29)6-3-5-26-32(30,31)7-2-4-10(13(17,18)19)8-12(16,14(20,21)22)15(23,24)25/h10,26H,2-9H2,1H3,(H,28,29) |
| InChIKey | KZXPINLSSQYKNW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|