C16H25F12N2O2S+ — CID 59721669
trimethyl-[2-[[8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octyl]sulfonylamino]ethyl]azanium (PubChem CID 59721669) has the molecular formula C16H25F12N2O2S+ and a molecular weight of 537.43 g/mol. Its IUPAC name is trimethyl-[2-[[8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octyl]sulfonylamino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octyl]sulfonylamino]ethyl]azanium |
|---|---|
| PubChem CID | 59721669 |
| Molecular Formula | C16H25F12N2O2S+ |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | trimethyl-[2-[[8,8,8-trifluoro-5,7,7-tris(trifluoromethyl)octyl]sulfonylamino]ethyl]azanium |
| SMILES | C[N+](C)(C)CCNS(=O)(=O)CCCCC(CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H25F12N2O2S/c1-30(2,3)8-7-29-33(31,32)9-5-4-6-11(13(17,18)19)10-12(14(20,21)22,15(23,24)25)16(26,27)28/h11,29H,4-10H2,1-3H3/q+1 |
| InChIKey | LAKUCQACBWCBES-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|