C13H25F4N2O4S+ — CID 87159188
carboxymethyl-dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azanium (PubChem CID 87159188) has the molecular formula C13H25F4N2O4S+ and a molecular weight of 381.41 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azanium |
|---|---|
| PubChem CID | 87159188 |
| Molecular Formula | C13H25F4N2O4S+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azanium |
| SMILES | CC(F)(CCCS(=O)(=O)NCCC[N+](C)(C)CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H24F4N2O4S/c1-12(14,13(15,16)17)6-4-9-24(22,23)18-7-5-8-19(2,3)10-11(20)21/h18H,4-10H2,1-3H3/p+1 |
| InChIKey | KZKRRWRULJJABP-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|