C19H18F25N2O3S+ — CID 163324882
hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecylsulfonylamino)propyl]azanium (PubChem CID 163324882) has the molecular formula C19H18F25N2O3S+ and a molecular weight of 829.38 g/mol. Its IUPAC name is hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecylsulfonylamino)propyl]azanium.
| Compound Name | hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 163324882 |
| Molecular Formula | C19H18F25N2O3S+ |
| Molecular Weight | 829.38 g/mol |
| Exact Mass | 829.06 |
| IUPAC Name | hydroxy-dimethyl-[3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecylsulfonylamino)propyl]azanium |
| SMILES | C[N+](C)(O)CCCNS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H18F25N2O3S/c1-46(2,47)6-3-5-45-50(48,49)7-4-8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)16(36,37)17(38,39)18(40,41)19(42,43)44/h45,47H,3-7H2,1-2H3/q+1 |
| InChIKey | CXZZTOLJZYOJOY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.38 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|