C13H24F4N2O4S — CID 159285219
2-[dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azaniumyl]acetate (PubChem CID 159285219) has the molecular formula C13H24F4N2O4S and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azaniumyl]acetate.
| Compound Name | 2-[dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 159285219 |
| Molecular Formula | C13H24F4N2O4S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[dimethyl-[3-[(4,5,5,5-tetrafluoro-4-methylpentyl)sulfonylamino]propyl]azaniumyl]acetate |
| SMILES | CC(F)(CCCS(=O)(=O)NCCC[N+](C)(C)CC(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C13H24F4N2O4S/c1-12(14,13(15,16)17)6-4-9-24(22,23)18-7-5-8-19(2,3)10-11(20)21/h18H,4-10H2,1-3H3 |
| InChIKey | KZKRRWRULJJABP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|