C11H14F9NO2 — CID 165364898
2-[dimethyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)azaniumyl]acetate (PubChem CID 165364898) has the molecular formula C11H14F9NO2 and a molecular weight of 363.22 g/mol. Its IUPAC name is 2-[dimethyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)azaniumyl]acetate.
| Compound Name | 2-[dimethyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)azaniumyl]acetate |
|---|---|
| PubChem CID | 165364898 |
| Molecular Formula | C11H14F9NO2 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-[dimethyl(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)azaniumyl]acetate |
| SMILES | C[N+](C)(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)[O-] |
| InChI | InChI=1S/C11H14F9NO2/c1-21(2,6-7(22)23)5-3-4-8(12,13)9(14,15)10(16,17)11(18,19)20/h3-6H2,1-2H3 |
| InChIKey | AVZGNWJFUUZVEX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|