C15H21F9N2O3S — CID 138394292
2-[dimethyl-[3-[[2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)acetyl]amino]propyl]azaniumyl]acetate (PubChem CID 138394292) has the molecular formula C15H21F9N2O3S and a molecular weight of 480.39 g/mol. Its IUPAC name is 2-[dimethyl-[3-[[2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)acetyl]amino]propyl]azaniumyl]acetate.
| Compound Name | 2-[dimethyl-[3-[[2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)acetyl]amino]propyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 138394292 |
| Molecular Formula | C15H21F9N2O3S |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[dimethyl-[3-[[2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)acetyl]amino]propyl]azaniumyl]acetate |
| SMILES | C[N+](C)(CCCNC(=O)CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)[O-] |
| InChI | InChI=1S/C15H21F9N2O3S/c1-26(2,8-11(28)29)6-3-5-25-10(27)9-30-7-4-12(16,17)13(18,19)14(20,21)15(22,23)24/h3-9H2,1-2H3,(H-,25,27,28,29) |
| InChIKey | BPAWUUWJZZQNHZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|