C26H24F26N2O6 — CID 58912397
2-[2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-dimethylazaniumyl]acetate (PubChem CID 58912397) has the molecular formula C26H24F26N2O6 and a molecular weight of 954.43 g/mol. Its IUPAC name is 2-[2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-dimethylazaniumyl]acetate.
| Compound Name | 2-[2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-dimethylazaniumyl]acetate |
|---|---|
| PubChem CID | 58912397 |
| Molecular Formula | C26H24F26N2O6 |
| Molecular Weight | 954.43 g/mol |
| Exact Mass | 954.12 |
| IUPAC Name | 2-[2-[[1,4-dioxo-1,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)butan-2-yl]amino]ethyl-dimethylazaniumyl]acetate |
| SMILES | C[N+](C)(CCNC(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)[O-] |
| InChI | InChI=1S/C26H24F26N2O6/c1-54(2,10-12(55)56)6-5-53-11(14(58)60-8-4-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52)9-13(57)59-7-3-15(27,28)17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49/h11,53H,3-10H2,1-2H3 |
| InChIKey | VPARZDBIHAJOKP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.43 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|