C22H16BrF30NO3 — CID 10909239
(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hydroxydecyl)-dimethyl-[2-oxo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)ethyl]azanium bromide (PubChem CID 10909239) has the molecular formula C22H16BrF30NO3 and a molecular weight of 992.22 g/mol. Its IUPAC name is (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hydroxydecyl)-dimethyl-[2-oxo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)ethyl]azanium bromide.
| Compound Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hydroxydecyl)-dimethyl-[2-oxo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)ethyl]azanium bromide |
|---|---|
| PubChem CID | 10909239 |
| Molecular Formula | C22H16BrF30NO3 |
| Molecular Weight | 992.22 g/mol |
| Exact Mass | 990.98 |
| IUPAC Name | (3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-hydroxydecyl)-dimethyl-[2-oxo-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)ethyl]azanium bromide |
| SMILES | C[N+](C)(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Br-] |
| InChI | InChI=1S/C22H16F30NO3.BrH/c1-53(2,6-8(55)56-4-3-9(23,24)11(27,28)13(31,32)17(39,40)19(43,44)21(47,48)49)5-7(54)10(25,26)12(29,30)14(33,34)15(35,36)16(37,38)18(41,42)20(45,46)22(50,51)52;/h7,54H,3-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | BSQIIQJXVBSOET-UHFFFAOYSA-M |
| XLogP | 6.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 992.22 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|