C22H25F18N2O5+ — CID 21057590
[3-[[1,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium (PubChem CID 21057590) has the molecular formula C22H25F18N2O5+ and a molecular weight of 739.41 g/mol. Its IUPAC name is [3-[[1,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium.
| Compound Name | [3-[[1,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium |
|---|---|
| PubChem CID | 21057590 |
| Molecular Formula | C22H25F18N2O5+ |
| Molecular Weight | 739.41 g/mol |
| Exact Mass | 739.15 |
| IUPAC Name | [3-[[1,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-1,4-dioxobutan-2-yl]amino]-3-oxopropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CCC(=O)NC(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H24F18N2O5/c1-42(2,3)7-4-12(43)41-11(14(45)47-9-6-16(25,26)18(29,30)20(33,34)22(38,39)40)10-13(44)46-8-5-15(23,24)17(27,28)19(31,32)21(35,36)37/h11H,4-10H2,1-3H3/p+1 |
| InChIKey | UIVWOKOHGKSPCR-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|