C26H27F26N2O4+ — CID 91472240
trimethyl-[2-[[4-oxo-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxycarbonyl)butyl]amino]ethyl]azanium (PubChem CID 91472240) has the molecular formula C26H27F26N2O4+ and a molecular weight of 925.46 g/mol. Its IUPAC name is trimethyl-[2-[[4-oxo-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxycarbonyl)butyl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[4-oxo-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxycarbonyl)butyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 91472240 |
| Molecular Formula | C26H27F26N2O4+ |
| Molecular Weight | 925.46 g/mol |
| Exact Mass | 925.16 |
| IUPAC Name | trimethyl-[2-[[4-oxo-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxy)-2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctoxycarbonyl)butyl]amino]ethyl]azanium |
| SMILES | C[N+](C)(C)CCNCC(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H27F26N2O4/c1-54(2,3)7-6-53-11-12(14(56)58-9-5-16(29,30)18(33,34)20(37,38)22(41,42)24(45,46)26(50,51)52)10-13(55)57-8-4-15(27,28)17(31,32)19(35,36)21(39,40)23(43,44)25(47,48)49/h12,53H,4-11H2,1-3H3/q+1 |
| InChIKey | MHWPRTIANRARLC-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.46 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|