C20H16F29N2+ — CID 163324364
trimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-nonacosafluoropentadecylamino)ethyl]azanium (PubChem CID 163324364) has the molecular formula C20H16F29N2+ and a molecular weight of 835.30 g/mol. Its IUPAC name is trimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-nonacosafluoropentadecylamino)ethyl]azanium.
| Compound Name | trimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-nonacosafluoropentadecylamino)ethyl]azanium |
|---|---|
| PubChem CID | 163324364 |
| Molecular Formula | C20H16F29N2+ |
| Molecular Weight | 835.30 g/mol |
| Exact Mass | 835.08 |
| IUPAC Name | trimethyl-[2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-nonacosafluoropentadecylamino)ethyl]azanium |
| SMILES | C[N+](C)(C)CCNCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16F29N2/c1-51(2,3)5-4-50-6-7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)13(33,34)14(35,36)15(37,38)16(39,40)17(41,42)18(43,44)19(45,46)20(47,48)49/h50H,4-6H2,1-3H3/q+1 |
| InChIKey | VYIOZPLBTGUCLK-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.30 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|