C12H20F9N2O2S+ — CID 165360018
trimethyl-[3-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethylamino]propyl]azanium (PubChem CID 165360018) has the molecular formula C12H20F9N2O2S+ and a molecular weight of 427.35 g/mol. Its IUPAC name is trimethyl-[3-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethylamino]propyl]azanium.
| Compound Name | trimethyl-[3-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethylamino]propyl]azanium |
|---|---|
| PubChem CID | 165360018 |
| Molecular Formula | C12H20F9N2O2S+ |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | trimethyl-[3-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)ethylamino]propyl]azanium |
| SMILES | C[N+](C)(C)CCCNCCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H20F9N2O2S/c1-23(2,3)7-4-5-22-6-8-26(24,25)12(20,21)10(15,16)9(13,14)11(17,18)19/h22H,4-8H2,1-3H3/q+1 |
| InChIKey | FXIFOCWBWZXBMZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|