C17H13F25N2O3S — CID 165364501
N,N-dimethyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propan-1-amine oxide (PubChem CID 165364501) has the molecular formula C17H13F25N2O3S and a molecular weight of 800.32 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propan-1-amine oxide |
|---|---|
| PubChem CID | 165364501 |
| Molecular Formula | C17H13F25N2O3S |
| Molecular Weight | 800.32 g/mol |
| Exact Mass | 800.02 |
| IUPAC Name | N,N-dimethyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F25N2O3S/c1-44(2,45)5-3-4-43-48(46,47)17(41,42)15(36,37)13(32,33)11(28,29)9(24,25)7(20,21)6(18,19)8(22,23)10(26,27)12(30,31)14(34,35)16(38,39)40/h43H,3-5H2,1-2H3 |
| InChIKey | VDVXYSBECMOGPE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.32 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|