C14H22F11N2O4S+ — CID 139597766
3,4-dihydroxybutyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium (PubChem CID 139597766) has the molecular formula C14H22F11N2O4S+ and a molecular weight of 523.39 g/mol. Its IUPAC name is 3,4-dihydroxybutyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium.
| Compound Name | 3,4-dihydroxybutyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 139597766 |
| Molecular Formula | C14H22F11N2O4S+ |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 3,4-dihydroxybutyl-dimethyl-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(O)CO |
| InChI | InChI=1S/C14H22F11N2O4S/c1-27(2,7-4-9(29)8-28)6-3-5-26-32(30,31)14(24,25)12(19,20)10(15,16)11(17,18)13(21,22)23/h9,26,28-29H,3-8H2,1-2H3/q+1 |
| InChIKey | WXVAPDQRFHNNTQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|