C19H18F25N2O4S+ — CID 163324228
2-hydroxyethyl-[2-hydroxy-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propyl]-dimethylazanium (PubChem CID 163324228) has the molecular formula C19H18F25N2O4S+ and a molecular weight of 845.38 g/mol. Its IUPAC name is 2-hydroxyethyl-[2-hydroxy-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propyl]-dimethylazanium.
| Compound Name | 2-hydroxyethyl-[2-hydroxy-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 163324228 |
| Molecular Formula | C19H18F25N2O4S+ |
| Molecular Weight | 845.38 g/mol |
| Exact Mass | 845.06 |
| IUPAC Name | 2-hydroxyethyl-[2-hydroxy-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecylsulfonylamino)propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCO)CC(O)CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H18F25N2O4S/c1-46(2,3-4-47)6-7(48)5-45-51(49,50)19(43,44)17(38,39)15(34,35)13(30,31)11(26,27)9(22,23)8(20,21)10(24,25)12(28,29)14(32,33)16(36,37)18(40,41)42/h7,45,47-48H,3-6H2,1-2H3/q+1 |
| InChIKey | CNFAMKWLXIHLBE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.38 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|