C8H5F13S — CID 129075143
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-methylsulfanylheptane (PubChem CID 129075143) has the molecular formula C8H5F13S and a molecular weight of 380.17 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-methylsulfanylheptane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-methylsulfanylheptane |
|---|---|
| PubChem CID | 129075143 |
| Molecular Formula | C8H5F13S |
| Molecular Weight | 380.17 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-methylsulfanylheptane |
| SMILES | CSCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F13S/c1-22-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h2H2,1H3 |
| InChIKey | MHXZUWRIFLHLCZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.17 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|