C7H5F11O — CID 71669115
1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methoxyhexane (PubChem CID 71669115) has the molecular formula C7H5F11O and a molecular weight of 314.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methoxyhexane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methoxyhexane |
|---|---|
| PubChem CID | 71669115 |
| Molecular Formula | C7H5F11O |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-methoxyhexane |
| SMILES | COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F11O/c1-19-2-3(8,9)4(10,11)5(12,13)6(14,15)7(16,17)18/h2H2,1H3 |
| InChIKey | XRLUUNOJPPKNQS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|