C12H17F9O4 — CID 102378165
1,1,1,2,2,3,3,4,4-nonafluoro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pentane (PubChem CID 102378165) has the molecular formula C12H17F9O4 and a molecular weight of 396.25 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pentane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pentane |
|---|---|
| PubChem CID | 102378165 |
| Molecular Formula | C12H17F9O4 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pentane |
| SMILES | COCCOCCOCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F9O4/c1-22-2-3-23-4-5-24-6-7-25-8-9(13,14)10(15,16)11(17,18)12(19,20)21/h2-8H2,1H3 |
| InChIKey | MIMVXAVBLJLKDM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|