C16H4F30ORb — CID 158938378
CID 158938378 (PubChem CID 158938378) has the molecular formula C16H4F30ORb and a molecular weight of 867.61 g/mol.
| Compound Name | CID 158938378 |
|---|---|
| PubChem CID | 158938378 |
| Molecular Formula | C16H4F30ORb |
| Molecular Weight | 867.61 g/mol |
| Exact Mass | 866.89 |
| IUPAC Name | — |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Rb] |
| InChI | InChI=1S/C16H4F30O.Rb/c17-3(18,5(21,22)7(25,26)9(29,30)11(33,34)13(37,38)15(41,42)43)1-47-2-4(19,20)6(23,24)8(27,28)10(31,32)12(35,36)14(39,40)16(44,45)46;/h1-2H2; |
| InChIKey | JJXZBVKCUMRIEB-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.61 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|