C9H6F11NO — CID 98460783
3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propanenitrile (PubChem CID 98460783) has the molecular formula C9H6F11NO and a molecular weight of 353.13 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propanenitrile.
| Compound Name | 3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propanenitrile |
|---|---|
| PubChem CID | 98460783 |
| Molecular Formula | C9H6F11NO |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propanenitrile |
| SMILES | N#CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F11NO/c10-5(11,4-22-3-1-2-21)6(12,13)7(14,15)8(16,17)9(18,19)20/h1,3-4H2 |
| InChIKey | FQLJHWUFZMXZLW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|