C10H10F9N — CID 139685068
7,7,8,8,9,9,10,10,10-nonafluorodecanenitrile (PubChem CID 139685068) has the molecular formula C10H10F9N and a molecular weight of 315.18 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,10-nonafluorodecanenitrile.
| Compound Name | 7,7,8,8,9,9,10,10,10-nonafluorodecanenitrile |
|---|---|
| PubChem CID | 139685068 |
| Molecular Formula | C10H10F9N |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 7,7,8,8,9,9,10,10,10-nonafluorodecanenitrile |
| SMILES | N#CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F9N/c11-7(12,5-3-1-2-4-6-20)8(13,14)9(15,16)10(17,18)19/h1-5H2 |
| InChIKey | BYLDTIRRWMEPOT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|