C12H11F13NP — CID 101363305
3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononylphosphanyl)propanenitrile (PubChem CID 101363305) has the molecular formula C12H11F13NP and a molecular weight of 447.18 g/mol. Its IUPAC name is 3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononylphosphanyl)propanenitrile.
| Compound Name | 3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononylphosphanyl)propanenitrile |
|---|---|
| PubChem CID | 101363305 |
| Molecular Formula | C12H11F13NP |
| Molecular Weight | 447.18 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononylphosphanyl)propanenitrile |
| SMILES | N#CCCPCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13NP/c13-7(14,3-1-5-27-6-2-4-26)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h27H,1-3,5-6H2 |
| InChIKey | CGEFUPZNKYBFTO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.18 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|