C8H7F8NO — CID 131854633
3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propanenitrile (PubChem CID 131854633) has the molecular formula C8H7F8NO and a molecular weight of 285.13 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propanenitrile.
| Compound Name | 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propanenitrile |
|---|---|
| PubChem CID | 131854633 |
| Molecular Formula | C8H7F8NO |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propanenitrile |
| SMILES | N#CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H7F8NO/c9-5(10)7(13,14)8(15,16)6(11,12)4-18-3-1-2-17/h5H,1,3-4H2 |
| InChIKey | ULFXSZIGGKPAMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|