C10H9Cl3F12OSi — CID 142755459
trichloro-[3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl]silane (PubChem CID 142755459) has the molecular formula C10H9Cl3F12OSi and a molecular weight of 507.60 g/mol. Its IUPAC name is trichloro-[3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl]silane.
| Compound Name | trichloro-[3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl]silane |
|---|---|
| PubChem CID | 142755459 |
| Molecular Formula | C10H9Cl3F12OSi |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 505.93 |
| IUPAC Name | trichloro-[3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl]silane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COCCC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3F12OSi/c11-27(12,13)3-1-2-26-4-6(16,17)8(20,21)10(24,25)9(22,23)7(18,19)5(14)15/h5H,1-4H2 |
| InChIKey | AVSUJOHTGYRBKJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|