C8H4F12O — CID 58700662
CID 58700662 (PubChem CID 58700662) has the molecular formula C8H4F12O and a molecular weight of 344.10 g/mol.
| Compound Name | CID 58700662 |
|---|---|
| PubChem CID | 58700662 |
| Molecular Formula | C8H4F12O |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | — |
| SMILES | [CH]OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H4F12O/c1-21-2-4(11,12)6(15,16)8(19,20)7(17,18)5(13,14)3(9)10/h1,3H,2H2 |
| InChIKey | UPLDKHHXBVWRNI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|