C15H12F20O3 — CID 172565018
1,3-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxy)propan-2-ol (PubChem CID 172565018) has the molecular formula C15H12F20O3 and a molecular weight of 620.22 g/mol. Its IUPAC name is 1,3-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxy)propan-2-ol.
| Compound Name | 1,3-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxy)propan-2-ol |
|---|---|
| PubChem CID | 172565018 |
| Molecular Formula | C15H12F20O3 |
| Molecular Weight | 620.22 g/mol |
| Exact Mass | 620.05 |
| IUPAC Name | 1,3-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H12F20O3/c16-6(17)10(24,25)14(32,33)12(28,29)8(20,21)3-37-1-5(36)2-38-4-9(22,23)13(30,31)15(34,35)11(26,27)7(18)19/h5-7,36H,1-4H2 |
| InChIKey | WUWUMYVYROIVTD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.22 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|