C22H30F16N2O4+2 — CID 58194915
1-[4-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol (PubChem CID 58194915) has the molecular formula C22H30F16N2O4+2 and a molecular weight of 690.46 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol.
| Compound Name | 1-[4-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol |
|---|---|
| PubChem CID | 58194915 |
| Molecular Formula | C22H30F16N2O4+2 |
| Molecular Weight | 690.46 g/mol |
| Exact Mass | 690.19 |
| IUPAC Name | 1-[4-[2-hydroxy-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl]-1,4-diazoniabicyclo[2.2.2]octan-1-yl]-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)(F)C(F)(F)C(F)F)C[N+]12CC[N+](CC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)F)(CC1)CC2 |
| InChI | InChI=1S/C22H30F16N2O4/c23-15(24)19(31,32)21(35,36)17(27,28)11-43-9-13(41)7-39-1-2-40(5-3-39,6-4-39)8-14(42)10-44-12-18(29,30)22(37,38)20(33,34)16(25)26/h13-16,41-42H,1-12H2/q+2 |
| InChIKey | XCWSYRYIKUFHIO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|