C10H12F8O3 — CID 139989487
4,4,5,5,6,6,7,7-octafluoro-1-(oxiran-2-ylmethoxy)heptan-2-ol (PubChem CID 139989487) has the molecular formula C10H12F8O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-1-(oxiran-2-ylmethoxy)heptan-2-ol.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-1-(oxiran-2-ylmethoxy)heptan-2-ol |
|---|---|
| PubChem CID | 139989487 |
| Molecular Formula | C10H12F8O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-1-(oxiran-2-ylmethoxy)heptan-2-ol |
| SMILES | OC(COCC1CO1)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H12F8O3/c11-7(12)9(15,16)10(17,18)8(13,14)1-5(19)2-20-3-6-4-21-6/h5-7,19H,1-4H2 |
| InChIKey | CXYRHUYGHHZKHC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|