C8H8F8O — CID 123662716
2-(3,3,4,4,5,5,6,6-octafluorohexyl)oxirane (PubChem CID 123662716) has the molecular formula C8H8F8O and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,6,6-octafluorohexyl)oxirane.
| Compound Name | 2-(3,3,4,4,5,5,6,6-octafluorohexyl)oxirane |
|---|---|
| PubChem CID | 123662716 |
| Molecular Formula | C8H8F8O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(3,3,4,4,5,5,6,6-octafluorohexyl)oxirane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)CCC1CO1 |
| InChI | InChI=1S/C8H8F8O/c9-5(10)7(13,14)8(15,16)6(11,12)2-1-4-3-17-4/h4-5H,1-3H2 |
| InChIKey | SGVFQFYVRYIINO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|