C11H7F15O2 — CID 22715504
2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctoxymethyl)oxirane (PubChem CID 22715504) has the molecular formula C11H7F15O2 and a molecular weight of 456.15 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctoxymethyl)oxirane.
| Compound Name | 2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctoxymethyl)oxirane |
|---|---|
| PubChem CID | 22715504 |
| Molecular Formula | C11H7F15O2 |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctoxymethyl)oxirane |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)OCC1CO1 |
| InChI | InChI=1S/C11H7F15O2/c12-4(13)6(15,16)8(19,20)10(23,24)11(25,26)9(21,22)7(17,18)5(14)28-2-3-1-27-3/h3-5H,1-2H2 |
| InChIKey | IFSMXWWQWAFWHC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|