C19H14F24O4 — CID 139989559
2-(oxiran-2-ylmethoxy)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-tetracosafluorotridecoxy)propan-1-ol (PubChem CID 139989559) has the molecular formula C19H14F24O4 and a molecular weight of 762.27 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxy)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-tetracosafluorotridecoxy)propan-1-ol.
| Compound Name | 2-(oxiran-2-ylmethoxy)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-tetracosafluorotridecoxy)propan-1-ol |
|---|---|
| PubChem CID | 139989559 |
| Molecular Formula | C19H14F24O4 |
| Molecular Weight | 762.27 g/mol |
| Exact Mass | 762.05 |
| IUPAC Name | 2-(oxiran-2-ylmethoxy)-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13-tetracosafluorotridecoxy)propan-1-ol |
| SMILES | OCC(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)OCC1CO1 |
| InChI | InChI=1S/C19H14F24O4/c20-8(21)10(24,25)12(28,29)14(32,33)16(36,37)18(40,41)19(42,43)17(38,39)15(34,35)13(30,31)11(26,27)9(22,23)5-45-2-6(1-44)46-3-7-4-47-7/h6-8,44H,1-5H2 |
| InChIKey | NEVWCSURRGDIKW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.27 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|