C8H10F8O3 — CID 14909231
3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propane-1,2-diol (PubChem CID 14909231) has the molecular formula C8H10F8O3 and a molecular weight of 306.15 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propane-1,2-diol.
| Compound Name | 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 14909231 |
| Molecular Formula | C8H10F8O3 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propane-1,2-diol |
| SMILES | OCC(O)COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F8O3/c9-5(10)7(13,14)8(15,16)6(11,12)3-19-2-4(18)1-17/h4-5,17-18H,1-3H2 |
| InChIKey | XQNPGKQYINWYIF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|