C10H10F12O3 — CID 142737837
1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol (PubChem CID 142737837) has the molecular formula C10H10F12O3 and a molecular weight of 406.16 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol.
| Compound Name | 1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 142737837 |
| Molecular Formula | C10H10F12O3 |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-(2,2,3,3,3-pentafluoropropoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)(F)F)COCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F12O3/c11-6(12,8(15,16)10(20,21)22)3-24-1-5(23)2-25-4-7(13,14)9(17,18)19/h5,23H,1-4H2 |
| InChIKey | RTRGCZMCNVBHNP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|