C12H9F17O4 — CID 142549364
1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-ol (PubChem CID 142549364) has the molecular formula C12H9F17O4 and a molecular weight of 540.17 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-ol.
| Compound Name | 1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 142549364 |
| Molecular Formula | C12H9F17O4 |
| Molecular Weight | 540.17 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | 1-(2,2,3,3,4,4,4-heptafluorobutoxy)-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]propan-2-ol |
| SMILES | OC(COCC(F)(F)C(F)(F)C(F)(F)F)COC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F17O4/c13-5(33-12(28,29)9(20,21)11(25,26)27)7(16,17)32-2-4(30)1-31-3-6(14,15)8(18,19)10(22,23)24/h4-5,30H,1-3H2 |
| InChIKey | XDHBENLTTKWIEI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.17 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|