C12H3F21O3 — CID 175997125
1,1,2,2,3,3,4,4,5,5-decafluoro-1-(1,2,2-trifluoroethenoxy)-6-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]hexane (PubChem CID 175997125) has the molecular formula C12H3F21O3 and a molecular weight of 594.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoro-1-(1,2,2-trifluoroethenoxy)-6-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]hexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-1-(1,2,2-trifluoroethenoxy)-6-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]hexane |
|---|---|
| PubChem CID | 175997125 |
| Molecular Formula | C12H3F21O3 |
| Molecular Weight | 594.11 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-1-(1,2,2-trifluoroethenoxy)-6-[1,1,2-trifluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]hexane |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(F)(F)C(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F21O3/c13-2(14)3(15)35-11(30,31)9(25,26)8(23,24)7(21,22)5(17,18)1-34-6(19,20)4(16)36-12(32,33)10(27,28)29/h4H,1H2 |
| InChIKey | YDJHDKOWHQAPLH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.11 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|