C11H6F16O3 — CID 175997126
1-(2-ethoxy-1,2,2-trifluoroethoxy)-1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane (PubChem CID 175997126) has the molecular formula C11H6F16O3 and a molecular weight of 490.13 g/mol. Its IUPAC name is 1-(2-ethoxy-1,2,2-trifluoroethoxy)-1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane.
| Compound Name | 1-(2-ethoxy-1,2,2-trifluoroethoxy)-1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane |
|---|---|
| PubChem CID | 175997126 |
| Molecular Formula | C11H6F16O3 |
| Molecular Weight | 490.13 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 1-(2-ethoxy-1,2,2-trifluoroethoxy)-1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane |
| SMILES | CCOC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C11H6F16O3/c1-2-28-6(16,17)5(15)30-11(26,27)9(22,23)7(18,19)8(20,21)10(24,25)29-4(14)3(12)13/h5H,2H2,1H3 |
| InChIKey | BDCQYGCJQHZLEK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.13 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|