C7F14O3S — CID 175997144
1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane-1-sulfonyl fluoride (PubChem CID 175997144) has the molecular formula C7F14O3S and a molecular weight of 430.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane-1-sulfonyl fluoride.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 175997144 |
| Molecular Formula | C7F14O3S |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluoro-5-(1,2,2-trifluoroethenoxy)pentane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C7F14O3S/c8-1(9)2(10)24-6(17,18)4(13,14)3(11,12)5(15,16)7(19,20)25(21,22)23 |
| InChIKey | JLLMZYXTIOGMKH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|