C6F12O5S2 — CID 154980162
2-[difluoro(1,2,2-trifluoroethenoxy)methyl]-1,1,2,3,3-pentafluoropropane-1,3-disulfonyl fluoride (PubChem CID 154980162) has the molecular formula C6F12O5S2 and a molecular weight of 444.17 g/mol. Its IUPAC name is 2-[difluoro(1,2,2-trifluoroethenoxy)methyl]-1,1,2,3,3-pentafluoropropane-1,3-disulfonyl fluoride.
| Compound Name | 2-[difluoro(1,2,2-trifluoroethenoxy)methyl]-1,1,2,3,3-pentafluoropropane-1,3-disulfonyl fluoride |
|---|---|
| PubChem CID | 154980162 |
| Molecular Formula | C6F12O5S2 |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 443.90 |
| IUPAC Name | 2-[difluoro(1,2,2-trifluoroethenoxy)methyl]-1,1,2,3,3-pentafluoropropane-1,3-disulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(C(F)(F)OC(F)=C(F)F)C(F)(F)S(=O)(=O)F |
| InChI | InChI=1S/C6F12O5S2/c7-1(8)2(9)23-4(11,12)3(10,5(13,14)24(17,19)20)6(15,16)25(18,21)22 |
| InChIKey | SHHLKXAJIQJGGE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|