C7HF13O5S — CID 22568765
1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfonic acid (PubChem CID 22568765) has the molecular formula C7HF13O5S and a molecular weight of 444.12 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 22568765 |
| Molecular Formula | C7HF13O5S |
| Molecular Weight | 444.12 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propoxy]ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C7HF13O5S/c8-1(9)2(10)24-4(13,14)3(11,12)5(15,16)25-6(17,18)7(19,20)26(21,22)23/h(H,21,22,23) |
| InChIKey | GOCWEKNFGHTVAA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|