C8HF15O5S — CID 137353314
1,1,2,2-tetrafluoro-2-[1,1,2,3,3,4,4,4-octafluoro-1-(1,2,2-trifluoroethenoxy)butan-2-yl]oxyethanesulfonic acid (PubChem CID 137353314) has the molecular formula C8HF15O5S and a molecular weight of 494.13 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,4,4,4-octafluoro-1-(1,2,2-trifluoroethenoxy)butan-2-yl]oxyethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,4,4,4-octafluoro-1-(1,2,2-trifluoroethenoxy)butan-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 137353314 |
| Molecular Formula | C8HF15O5S |
| Molecular Weight | 494.13 g/mol |
| Exact Mass | 493.93 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,3,3,4,4,4-octafluoro-1-(1,2,2-trifluoroethenoxy)butan-2-yl]oxyethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(C(F)(F)OC(F)=C(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O5S/c9-1(10)2(11)27-6(18,19)4(14,3(12,13)5(15,16)17)28-7(20,21)8(22,23)29(24,25)26/h(H,24,25,26) |
| InChIKey | RYEXLGANESCIDS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.13 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|