C8F16NNaO6S2 — CID 101009227
sodium [1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 101009227) has the molecular formula C8F16NNaO6S2 and a molecular weight of 597.18 g/mol. Its IUPAC name is sodium [1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | sodium [1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 101009227 |
| Molecular Formula | C8F16NNaO6S2 |
| Molecular Weight | 597.18 g/mol |
| Exact Mass | 596.88 |
| IUPAC Name | sodium [1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C8F16NO6S2.Na/c9-1(10)2(11)30-5(16,17)3(12,4(13,14)15)31-6(18,19)7(20,21)32(26,27)25-33(28,29)8(22,23)24;/q-1;+1 |
| InChIKey | VSJFQDKDEJMIFR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|