C8H2F13O5S- — CID 58445655
2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxypropane-1-sulfonate (PubChem CID 58445655) has the molecular formula C8H2F13O5S- and a molecular weight of 457.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxypropane-1-sulfonate.
| Compound Name | 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 58445655 |
| Molecular Formula | C8H2F13O5S- |
| Molecular Weight | 457.14 g/mol |
| Exact Mass | 456.94 |
| IUPAC Name | 2,2,3,3-tetrafluoro-3-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)=C(F)F |
| InChI | InChI=1S/C8H3F13O5S/c9-2(10)3(11)25-8(20,21)5(14,6(15,16)17)26-7(18,19)4(12,13)1-27(22,23)24/h1H2,(H,22,23,24)/p-1 |
| InChIKey | VRMAPOIROWNOLI-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.14 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|