C7F13IO2 — CID 11730669
1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)-3-(1,2,2-trifluoroethenoxy)propane (PubChem CID 11730669) has the molecular formula C7F13IO2 and a molecular weight of 489.95 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)-3-(1,2,2-trifluoroethenoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)-3-(1,2,2-trifluoroethenoxy)propane |
|---|---|
| PubChem CID | 11730669 |
| Molecular Formula | C7F13IO2 |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.87 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)-3-(1,2,2-trifluoroethenoxy)propane |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)I)C(F)(F)F |
| InChI | InChI=1S/C7F13IO2/c8-1(9)2(10)22-6(17,18)3(11,4(12,13)14)23-7(19,20)5(15,16)21 |
| InChIKey | PFSYCLSGANQBFH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|