C14F28I2O4 — CID 139632990
1,1,2,2,3,3,4,4-octafluoro-1,4-bis[[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-iodoethoxy)propan-2-yl]oxy]butane (PubChem CID 139632990) has the molecular formula C14F28I2O4 and a molecular weight of 1017.90 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-1,4-bis[[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-iodoethoxy)propan-2-yl]oxy]butane.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-1,4-bis[[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-iodoethoxy)propan-2-yl]oxy]butane |
|---|---|
| PubChem CID | 139632990 |
| Molecular Formula | C14F28I2O4 |
| Molecular Weight | 1017.90 g/mol |
| Exact Mass | 1017.74 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-1,4-bis[[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2-tetrafluoro-2-iodoethoxy)propan-2-yl]oxy]butane |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(F)C(F)(F)I)C(F)(F)OC(F)(F)C(F)(F)I |
| InChI | InChI=1S/C14F28I2O4/c15-1(16,9(31,32)45-3(19,5(21,22)23)11(35,36)47-13(39,40)7(27,28)43)2(17,18)10(33,34)46-4(20,6(24,25)26)12(37,38)48-14(41,42)8(29,30)44 |
| InChIKey | LPPNKPLVPVNCOK-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.90 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|